| Name | sebacoyl dichloride |
| Synonyms | NSC 56763 Sebacyl chloride Sebacoyl chloride sebacoyl dichloride Sebacoyl dichloride Decanedioyl chloride DECANEDIOYL CHLORIDE Decanedioyl dichloride Sebacic acid dichloride Sebacoyl chloride (8CI) SEBACOYLCHLORIDE,REAGENT octane-1,8-dicarbonyl chloride 1,8-Octanebis(carboxylic acid chloride) n-Octane-1,8-dicarboxylic acid dichloride |
| CAS | 111-19-3 |
| EINECS | 203-843-4 |
| InChI | InChI=1/C10H16Cl2O2/c11-9(13)7-5-3-1-2-4-6-8-10(12)14/h1-8H2 |
| Molecular Formula | C10H16Cl2O2 |
| Molar Mass | 239.14 |
| Density | 1.121g/mLat 25°C(lit.) |
| Melting Point | -2.5 °C |
| Boling Point | 220 °C |
| Flash Point | >230°F |
| Solubility | Miscible with hydrocarbons and ethers. |
| Vapor Presure | 0.000787mmHg at 25°C |
| Appearance | liquid |
| Specific Gravity | 1.121 |
| Color | yellow |
| BRN | 1365665 |
| Storage Condition | Store below +30°C. |
| Stability | Reacts violently with water liberating toxic gas. Incompatible with water, oxidizing agents, amines, alcohols. |
| Sensitive | Moisture Sensitive |
| Refractive Index | n20/D 1.468(lit.) |
| Risk Codes | R22 - Harmful if swallowed R24 - Toxic in contact with skin R34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | HD8454250 |
| FLUKA BRAND F CODES | 10-21 |
| TSCA | Yes |
| HS Code | 2917 19 80 |
| Hazard Class | 8 |
| Packing Group | II |
| Toxicity | LD50 orally in Rabbit: 400 mg/kg |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |